| Catalog Number |
ACM81103799-2 |
| CAS |
81103-79-9 |
| Structure |
 |
| Description |
Fluorene-d10 is the deuterium labeled Fluorene. Fluorene, a polycyclic aromatic hydrocarbon (PAH), is a precursor to other fluorene compounds. Fluorene and its derivative can be used as a precursor to fluorene-based dyes. |
| Molecular Weight |
176.28 |
| Molecular Formula |
C13D10 |
| Canonical SMILES |
[2H]C1([2H])C2=C(C3=C1C([2H])=C([2H])C([2H])=C3[2H])C([2H])=C([2H])C([2H])=C2[2H] |
| Purity |
≥99.0% |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
