Fenvalerate D7 (isopropyl D7) 100 µg/mL in Isooctane
| Catalog Number |
ACM2714485488 |
| CAS |
2714485-48-8 |
| Structure |
 |
| IUPAC Name |
[cyano-(3-phenoxyphenyl)methyl] 2-(4-chlorophenyl)-3,4,4,4-tetradeuterio-3-(trideuteriomethyl)butanoate |
| Molecular Weight |
426.94 |
| Molecular Formula |
C25D7H15ClNO3 |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])(C(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)c3ccc(Cl)cc3)C([2H])([2H])[2H] |
| InChI |
InChI=1S/C25H22ClNO3/c1-17(2)24(18-11-13-20(26)14-12-18)25(28)30-23(16-27)19-7-6-10-22(15-19)29-21-8-4-3-5-9-21/h3-15,17,23-24H,1-2H3/i1D3,2D3,17D |
| Storage |
+20 °C |
| Accurate Mass |
426.1728 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
