Fenpropidin D10 (piperidine D10) 100 µg/mL in Cyclohexane
| Catalog Number |
ACM2714437008 |
| CAS |
2714437-00-8 |
| Structure |
 |
| Synonyms |
Fenpropidin D10 (piperidine D10) |
| IUPAC Name |
1-[3-(4-tert-butylphenyl)-2-methylpropyl]-2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidine |
| Molecular Weight |
283.52 |
| Molecular Formula |
C19D10H21N |
| Canonical SMILES |
[2H]C1([2H])N(CC(C)Cc2ccc(cc2)C(C)(C)C)C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI |
InChI=1S/C19H31N/c1-16(15-20-12-6-5-7-13-20)14-17-8-10-18(11-9-17)19(2,3)4/h8-11,16H,5-7,12-15H2,1-4H3/i5D2,6D2,7D2,12D2,13D2 |
| Storage |
+20 °C |
| Accurate Mass |
283.3084 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
