| Catalog Number |
ACM1335401176-1 |
| CAS |
1335401-17-6 |
| Description |
Eugenol-d3 is the deuterium labeled Eugenol. Eugenol is an essential oil found in cloves with antibacterial, anthelmintic and antioxidant activity. Eugenol is shown to inhibit lipid peroxidation. |
| Synonyms |
4-Prop-2-enyl-2-(trideuteriomethoxy)phenol |
| IUPAC Name |
4-prop-2-enyl-2-(trideuteriomethoxy)phenol |
| Molecular Weight |
167.22 |
| Molecular Formula |
C10H9D3O2 |
| Canonical SMILES |
[2H]C([2H])([2H])OC1=CC(CC=C)=CC=C1O |
| InChI |
InChI=1S/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3,5-7,11H,1,4H2,2H3/i2D3 |
| InChI Key |
RRAFCDWBNXTKKO-BMSJAHLVSA-N |
| Purity |
0.9986 |
| Appearance |
Liquid |
| Storage |
Pure form: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Isomeric SMILES |
[2H]C([2H])([2H])OC1=C(C=CC(=C1)CC=C)O |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
| Unlabeled CAS |
97-53-0 |
