| Catalog Number |
ACM352431186 |
| CAS |
352431-18-6 |
| Structure |
 |
| Synonyms |
p-Ethylphenol |
| IUPAC Name |
1,2,4,5-tetradeuterio-3-deuteriooxy-6-(1,1,2,2,2-pentadeuterioethyl)benzene |
| Molecular Weight |
132.23 |
| Molecular Formula |
CD3CD2C6D4OD |
| InChI |
InChI=1S/C8H10O/c1-2-7-3-5-8(9)6-4-7/h3-6,9H,2H2,1H3/i1D3,2D2,3D,4D,5D,6D/hD |
| InChI Key |
HXDOZKJGKXYMEW-SQSZMTOTSA-N |
| Chemical Formula |
CD3CD2C6D4OD |
| Functional Group |
Alcohols & Phenols |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1C([2H])([2H])C([2H])([2H])[2H])[2H])[2H])O[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.25 g
In Stock
0.5 g
In Stock |
| Shipping Hazards |
CORROSIVE |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
123-07-9 |
| Unlabeled Synonyms |
p-Ethylphenol |
