| Catalog Number |
ACM203806080 |
| CAS |
203806-08-0 |
| Structure |
 |
| IUPAC Name |
2-[[2-[bis[carboxy(dideuterio)methyl]amino]-1,1,2,2-tetradeuterioethyl]-[carboxy(dideuterio)methyl]amino]-2,2-dideuterioacetic acid |
| Molecular Weight |
304.32 |
| Molecular Formula |
C10H4D12N2O8 |
| InChI |
InChI=1S/C10H16N2O8/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)/i1D2,2D2,3D2,4D2,5D2,6D2 |
| InChI Key |
KCXVZYZYPLLWCC-LBTWDOQPSA-N |
| Melting Point |
250 °C (dec.) (lit.) |
| Chemical Formula |
(HOOCCD2)2NCD2CD2N(CD2COOH)2 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C(=O)O)N(C([2H])([2H])C(=O)O)C([2H])([2H])C([2H])([2H])N(C([2H])([2H])C(=O)O)C([2H])([2H])C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| CAS (Unlabeled) |
60-00-4 |
| Synonyms (Unlabeled) |
Ethylenedinitrilotetraacetic acid; Edetic acid; EDTA |
