| Catalog Number |
ACM203805963 |
| CAS |
203805-96-3 |
| Structure |
 |
| Synonyms |
EDTA (D16) |
| IUPAC Name |
deuterio 2-[[2-[bis(1,1-dideuterio-2-deuteriooxy-2-oxoethyl)amino]-1,1,2,2-tetradeuterioethyl]-(1,1-dideuterio-2-deuteriooxy-2-oxoethyl)amino]-2,2-dideuterioacetate |
| Molecular Weight |
308.34 |
| Molecular Formula |
C10D16N2O8 |
| InChI |
InChI=1S/C10H16N2O8/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)/i1D2,2D2,3D2,4D2,5D2,6D2/hD4 |
| InChI Key |
KCXVZYZYPLLWCC-PZVDDEMOSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
(DOOCCD2)2NCD2CD2N(CD2COOD)2 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C(=O)O[2H])N(C([2H])([2H])C(=O)O[2H])C([2H])([2H])C([2H])([2H])N(C([2H])([2H])C(=O)O[2H])C([2H])([2H])C(=O)O[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| CAS (Unlabeled) |
60-00-4 |
| Synonyms (Unlabeled) |
Ethylenedinitrilotetraacetic acid; Edetic acid; EDTA |
