| Catalog Number |
ACM856765689-1 |
| CAS |
856765-68-9 |
| Structure |
 |
| Synonyms |
3-[2H5]phenylacrylic acid ethyl ester |
| IUPAC Name |
ethyl (E)-2,3-dideuterio-3-(2,3,4-trideuteriophenyl)prop-2-enoate |
| Molecular Weight |
181.25 |
| Molecular Formula |
C11H7D5O2 |
| InChI |
InChI=1S/C11H12O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h3-9H,2H2,1H3/b9-8+/i3D,4D,6D,8D,9D |
| InChI Key |
KBEBGUQPQBELIU-YSVLDWRHSA-N |
| Chemical Formula |
C6D5CH=CHCOOCH2CH3 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C=C1)/C(=C(\[2H])/C(=O)OCC)/[2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
103-36-6 |
| Unlabeled Synonyms |
Ethyl trans-3-phenylacrylate |
