| Catalog Number |
ACM1113009112 |
| CAS |
1113009-11-2 |
| Structure |
 |
| Synonyms |
Ethyl myristate-D27 |
| IUPAC Name |
ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptacosadeuteriotetradecanoate |
| Molecular Weight |
283.59 |
| Molecular Formula |
C16H5D27O2 |
| Canonical SMILES |
CC1CC(C(=O)C(C1)C(CC2CC(=O)NC(=O)C2)O)C |
| InChI |
InChI=1S/C16H32O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16(17)18-4-2/h3-15H2,1-2H3/i1D3,3D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D2,15D2 |
| InChI Key |
MMKRHZKQPFCLLS-XTVIBXJLSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CD3(CD2)12COOCH2CH3 |
| EC Number |
200-636-0 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)OCC |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
124-06-1 |
| Unlabeled Synonyms |
Ethyl myristate |
