Ethyl acetoacetate (1,3-13C2)
| Catalog Number |
ACM77504735-1 |
| CAS |
77504-73-5 |
| Structure |
 |
| Synonyms |
Ethyl 3-Oxobutanoate-1,3-13C2; Ethyl acetoacetate-[1,3-13C2] |
| IUPAC Name |
ethyl 3-oxo(1,3-13C2)butanoate |
| Molecular Weight |
132.13 |
| Molecular Formula |
13C2C4H10O3 |
| InChI |
InChI=1S/C6H10O3/c1-3-9-6(8)4-5(2)7/h3-4H2,1-2H3/i5+1,6+1 |
| InChI Key |
XYIBRDXRRQCHLP-MPOCSFTDSA-N |
| Boiling Point |
181 °C (358 °F) (lit.) |
| Melting Point |
-43 °C (-45 °F) (lit.) |
| Flash Point |
73.5 °C (164.3 °F)-closed cup |
| Purity |
98% |
| Density |
1.029 g/mL at 20 °C (68 °F) (lit.) |
| Solubility |
Water: 130 g/L at 20 °C (68 °F) |
| Appearance |
Colourless liquid |
| Chemical Formula |
CH3*COCH2*COOCH2CH3 |
| Isomeric SMILES |
CCO[13C](=O)C[13C](=O)C |
| Isotopic Enrichment |
99 atom % 13C |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
141-97-9 |
| Unlabeled Synonyms |
Acetoacetic ester |
Please kindly note that our products and services are for research use only.
