Ethyl 3-Hydroxy-3-methyl-d3-butyrate-4,4,4-d3
| Catalog Number |
ACM30385865 |
| CAS |
30385-86-5 |
| Structure |
 |
| Synonyms |
Ethyl 3-hydroxy-3-methyl-d3-butyrate-d3 |
| IUPAC Name |
ethyl 4,4,4-trideuterio-3-hydroxy-3-(trideuteriomethyl)butanoate |
| Molecular Weight |
152.22 |
| Molecular Formula |
C7H9D6O3 |
| InChI |
InChI=1S/C7H14O3/c1-4-10-6(8)5-7(2,3)9/h9H,4-5H2,1-3H3/i2D3,3D3 |
| InChI Key |
HKEDUIGHSRRIKD-XERRXZQWSA-N |
| Purity |
99 atom % D |
| Chemical Formula |
HO(CD3)2CCH2COOCH2CH3 |
| Isomeric SMILES |
[2H]C([2H])([2H])C(CC(=O)OCC)(C([2H])([2H])[2H])O |
| Isotopic Enrichment |
99 atom % D |
Please kindly note that our products and services are for research use only.
