Ethoprophos D5 (ethyl D5) 100 µg/mL in Cyclohexane
| Catalog Number |
ACM2733153950 |
| CAS |
2733153-95-0 |
| Structure |
 |
| Synonyms |
Ethoprophos D5 (ethyl D5) |
| IUPAC Name |
1-[1,1,2,2,2-pentadeuterioethoxy(propylsulfanyl)phosphoryl]sulfanylpropane |
| Molecular Weight |
247.37 |
| Molecular Formula |
C8D5H14O2PS2 |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])([2H])OP(=O)(SCCC)SCCC |
| InChI |
InChI=1S/C8H19O2PS2/c1-4-7-12-11(9,10-6-3)13-8-5-2/h4-8H2,1-3H3/i3D3,6D2 |
| Storage |
+20 °C |
| Accurate Mass |
247.0878 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
