Ethion D20 (tetra(ethyl D5)) 100 µg/mL in Acetone
| Catalog Number |
ACM2733154895 |
| CAS |
2733154-89-5 |
| Structure |
 |
| IUPAC Name |
bis(1,1,2,2,2-pentadeuterioethoxy)phosphinothioylsulfanylmethylsulfanyl-bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-?^{5}-phosphane |
| Molecular Weight |
404.6 |
| Molecular Formula |
C9D20H2O4P2S4 |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])([2H])OP(=S)(OC([2H])([2H])C([2H])([2H])[2H])SCSP(=S)(OC([2H])([2H])C([2H])([2H])[2H])OC([2H])([2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C9H22O4P2S4/c1-5-10-14(16,11-6-2)18-9-19-15(17,12-7-3)13-8-4/h5-9H2,1-4H3/i1D3,2D3,3D3,4D3,5D2,6D2,7D2,8D2 |
| Storage |
+20 °C |
| Accurate Mass |
404.1131 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
