| Catalog Number |
ACM56588546-1 |
| CAS |
56588-54-6 |
| Structure |
 |
| Synonyms |
3-Hydroxyestra-1,3,5(10),6,8-pentaen-17-one-d3 |
| IUPAC Name |
(13S,14S)-4,16,16-trideuterio-3-hydroxy-13-methyl-11,12,14,15-tetrahydrocyclopenta[a]phenanthren-17-one |
| Molecular Weight |
269.36 |
| Molecular Formula |
C18H15D3O2 |
| InChI |
InChI=1S/C18H18O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h2-5,10,16,19H,6-9H2,1H3/t16-,18-/m0/s1/i7D2,10D |
| InChI Key |
PDRGHUMCVRDZLQ-POWJHRNTSA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C=CC2=C1C=CC3=C2CC[C@]4([C@H]3CC(C4=O)([2H])[2H])C)O |
| Isotopic Enrichment |
97 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
517-09-9 |
| Unlabeled Synonyms |
1,3,5(10),6,8-Estrapentaen-3-ol-17-one |
