| Catalog Number |
ACM39756326 |
| CAS |
39756-32-6 |
| Structure |
 |
| Synonyms |
Arachidic acid-D39 |
| IUPAC Name |
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,20-nonatriacontadeuterioicosanoic acid |
| Molecular Weight |
351.77 |
| Molecular Formula |
C20HD39O2 |
| Canonical SMILES |
CCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI |
InChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D2,15D2,16D2,17D2,18D2,19D2 |
| InChI Key |
VKOBVWXKNCXXDE-BKDZISOFSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CD3(CD2)18COOH |
| Exact Mass |
351.54800 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
506-30-9 |
| Unlabeled Synonyms |
Arachidic acid |
