| Catalog Number |
ACM202480704-1 |
| CAS |
202480-70-4 |
| Structure |
 |
| Synonyms |
Arachidic Acid |
| IUPAC Name |
20,20,20-trideuterioicosanoic acid |
| Molecular Weight |
315.55 |
| Molecular Formula |
CD3(CH2)18COOH |
| InChI |
InChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22)/i1D3 |
| InChI Key |
VKOBVWXKNCXXDE-FIBGUPNXSA-N |
| Melting Point |
74-76 °C |
| Storage |
Keep container closed when no tin use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances |
| Chemical Formula |
CD3(CH2)18COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCCCCCCCCCCCCCC(=O)O |
| Isotopic Enrichment |
99%D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Type |
Fatty Acids 13C & 2H Alphabetical Listing |
| CAS (Unlabeled) |
506-30-9 |
| Synonyms (Unlabeled) |
Arachidic acid |
