| Catalog Number |
ACM335080961-1 |
| CAS |
335080-96-1 |
| Synonyms |
Arachidic acid-[1-13C] |
| IUPAC Name |
(1-13C)icosanoic acid |
| Molecular Weight |
313.54 |
| Molecular Formula |
13CC19H40O2 |
| InChI |
InChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22)/i20+1 |
| InChI Key |
VKOBVWXKNCXXDE-UUZXFVOJSA-N |
| Chemical Formula |
CH3(CH2)18*COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
CCCCCCCCCCCCCCCCCCC[13C](=O)O |
| Isotopic Enrichment |
99 atom % 13C |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
506-30-9 |
| Unlabeled Synonyms |
Arachidic acid |
