| Catalog Number |
ACM232600703 |
| CAS |
232600-70-3 |
| Structure |
 |
| Synonyms |
2,2-Dideuterioicosanoic acid |
| IUPAC Name |
2,2-dideuterioicosanoic acid |
| Molecular Weight |
314.55 |
| Molecular Formula |
C20H38D2O2 |
| InChI |
InChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22)/i19D2 |
| InChI Key |
VKOBVWXKNCXXDE-FKUWIZNHSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CH3(CH2)17CD2COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(CCCCCCCCCCCCCCCCCC)C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
506-30-9 |
| Unlabeled Synonyms |
Arachidic acid |
