Eicosanoic-17,17,18,18-d4 acid
| Catalog Number |
ACM1219803696-1 |
| CAS |
1219803-69-6 |
| IUPAC Name |
17,17,18,18-tetradeuterioicosanoic acid |
| Molecular Weight |
316.56 |
| Molecular Formula |
C20H36D4O2 |
| InChI |
InChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22)/i3D2,4D2 |
| InChI Key |
VKOBVWXKNCXXDE-KHORGVISSA-N |
| Chemical Formula |
CH3CH2(CD2)2(CH2)15COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(CC)C([2H])([2H])CCCCCCCCCCCCCCCC(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
506-30-9 |
| Unlabeled Synonyms |
Arachidic acid |
Please kindly note that our products and services are for research use only.
