Dopamine:HCl (2-(3,4-Dihydroxyphenyl)-ethylamine:HCl) (2,2-D2)
| Catalog Number |
ACM27160016-1 |
| CAS |
27160-01-6 |
| Structure |
 |
| Synonyms |
Dopamine-2,2-D2 |
| IUPAC Name |
4-(2-amino-1,1-dideuterioethyl)benzene-1,2-diol;hydrochloride |
| Molecular Weight |
191.65 |
| Molecular Formula |
C8H10ClD2NO2 |
| InChI |
InChI=1S/C8H11NO2.ClH/c9-4-3-6-1-2-7(10)8(11)5-6;/h1-2,5,10-11H,3-4,9H2;1H/i3D2; |
| InChI Key |
CTENFNNZBMHDDG-BCKZTNHCSA-N |
| Melting Point |
248-250 °C (478-482 °F) |
| Purity |
98% |
| Appearance |
White to brown powder |
| Chemical Formula |
(HO)2C6H3CD2CH2NH2·HCl |
| Isomeric SMILES |
[2H]C([2H])(CN)C1=CC(=C(C=C1)O)O.Cl |
| Isotopic Enrichment |
97-98 atom % D |
| pH |
3.0-5.5 at 40.0 g/L at 20 °C (68 °F) |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
62-31-7 |
Please kindly note that our products and services are for research use only.
