Catalog Number |
ACM59154437 |
CAS |
59154-43-7 |
Structure |
 |
Synonyms |
Dodecanoic-D23 acid |
IUPAC Name |
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosadeuteriododecanoic acid |
Molecular Weight |
223.46 |
Molecular Formula |
C12HD23O2 |
Canonical SMILES |
CCCCCCCCCCCC(=O)O |
InChI |
InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2 |
InChI Key |
POULHZVOKOAJMA-SJTGVFOPSA-N |
Boiling Point |
225 °C at 100 mmHg (lit.) |
Melting Point |
44-46 °C (lit.) |
Flash Point |
113 °C |
Purity |
98 atom % D |
Chemical Formula |
CD3(CD2)10COOH |
Exact Mass |
223.32200 |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
CAS (Unlabeled) |
143-07-7 |
Synonyms (Unlabeled) |
Lauric acid |