| Catalog Number |
ACM287100781 |
| CAS |
287100-78-1 |
| Structure |
 |
| Synonyms |
(213C)Dodecanoic acid |
| IUPAC Name |
(2-13C)dodecanoic acid |
| Molecular Weight |
201.33 |
| Molecular Formula |
13CC11H24O2 |
| InChI |
InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)/i11+1 |
| InChI Key |
POULHZVOKOAJMA-KHWBWMQUSA-N |
| Boiling Point |
225 °C at 100 mmHg (lit.) |
| Melting Point |
44-46 °C (lit.) |
| Purity |
99 atom % 13C |
| Chemical Formula |
CH3(CH2)9*CH2COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
CCCCCCCCCC[13CH2]C(=O)O |
| Isotopic Enrichment |
99 atom % 13C |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
143-07-7 |
| Unlabeled Synonyms |
Lauric acid |
