| Catalog Number |
ACM1219804382-1 |
| CAS |
1219804-38-2 |
| Synonyms |
Lauric acid-11,11,12,12,12-D5 |
| IUPAC Name |
11,11,12,12,12-pentadeuteriododecanoic acid |
| Molecular Weight |
205.35 |
| Molecular Formula |
C12H19D5O2 |
| InChI |
InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)/i1D3,2D2 |
| InChI Key |
POULHZVOKOAJMA-ZBJDZAJPSA-N |
| Chemical Formula |
CD3CD2(CH2)9COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])CCCCCCCCCC(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
143-07-7 |
| Unlabeled Synonyms |
Lauric acid |
