| Catalog Number |
ACM1193721651-1 |
| CAS |
1193721-65-1 |
| IUPAC Name |
7,7,8,8-tetradeuteriodocosanoic acid |
| Molecular Weight |
344.61 |
| Molecular Formula |
C22H40D4O2 |
| InChI |
InChI=1S/C22H44O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h2-21H2,1H3,(H,23,24)/i15D2,16D2 |
| InChI Key |
UKMSUNONTOPOIO-ONNKGWAKSA-N |
| Chemical Formula |
CH3(CH2)13(CD2)2(CH2)5COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(CCCCCCCCCCCCCC)C([2H])([2H])CCCCCC(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
112-85-6 |
| Unlabeled Synonyms |
Behenic acid |
