Docosanoic-22,22,22-d3 acid
| Catalog Number |
ACM1193721673-1 |
| CAS |
1193721-67-3 |
| Synonyms |
Behenic acid(D3); Docosanoic acid(D3) |
| IUPAC Name |
22,22,22-trideuteriodocosanoic acid |
| Molecular Weight |
343.61 |
| Molecular Formula |
C22H41D3O2 |
| InChI |
InChI=1S/C22H44O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h2-21H2,1H3,(H,23,24)/i1D3 |
| InChI Key |
UKMSUNONTOPOIO-FIBGUPNXSA-N |
| Chemical Formula |
CD3(CH2)20COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCCCCCCCCCCCCCCCC(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
112-85-6 |
| Unlabeled Synonyms |
Behenic acid |
Please kindly note that our products and services are for research use only.
