| Catalog Number |
ACM83181797-1 |
| CAS |
83181-79-7 |
| Structure |
 |
| IUPAC Name |
2-amino-2,3-dideuterio-3-methylbutanoic acid |
| Molecular Weight |
119.16 |
| Molecular Formula |
C5H9D2NO2 |
| Canonical SMILES |
[2H]C(C)(C)C([2H])(C(=O)O)N |
| InChI |
InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/i3D,4D |
| InChI Key |
KZSNJWFQEVHDMF-NMQOAUCRSA-N |
| Chemical Formula |
(CH3)2CDCD(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
516-06-3 |
| Unlabeled Synonyms |
(±)-2-Aminoisovaleric acid; H-DL-Val-OH |
