| Catalog Number |
ACM71261626-2 |
| CAS |
71261-62-6 |
| Structure |
 |
| Synonyms |
2-(15N)azanyl-3-methylbutanoic acid |
| Molecular Weight |
118.14 |
| Molecular Formula |
(CH3)2CHCH(15NH2)COOH |
| Canonical SMILES |
CC(C)[C@H]([15NH2])C(O)=O |
| InChI |
1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/i6+1 |
| InChI Key |
KZSNJWFQEVHDMF-PTQBSOBMSA-N |
| Appearance |
White to off-white solid |
| Application |
Biomolecular NMR, Metabolism, Metabolomics, Proteomics |
| Storage |
Keep container closed when no tin use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances |
| Isotopic Enrichment |
95-99%15N |
| Type |
Labeled Amino Acids and Derivatives |
| Unlabeled CAS |
516-06-3 |
