| Catalog Number |
ACM70094789-1 |
| CAS |
70094-78-9 |
| Structure |
 |
| Synonyms |
DL-Serine-2,3,3-D3 |
| IUPAC Name |
2-amino-2,3,3-trideuterio-3-hydroxypropanoic acid |
| Molecular Weight |
108.11 |
| Molecular Formula |
C3H4D3NO3 |
| Canonical SMILES |
[2H]C([2H])(C([2H])(C(=O)O)N)O |
| InChI |
InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/i1D2,2D |
| InChI Key |
MTCFGRXMJLQNBG-FUDHJZNOSA-N |
| Chemical Formula |
HOCD2CD(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
302-84-1 |
| Unlabeled Synonyms |
(±)-2-Amino-3-hydroxypropionic acid; β-Hydroxy-DL-alanine; H-DL-Ser-OH |
