| Catalog Number |
ACM286425421-1 |
| CAS |
286425-42-1 |
| Structure |
 |
| IUPAC Name |
2-amino-3-phenyl(3-13C)propanoic acid |
| Molecular Weight |
166.19 |
| Molecular Formula |
13CC8H11NO2 |
| Canonical SMILES |
C1=CC=C(C=C1)[13CH2]C(C(=O)O)N |
| InChI |
InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/i6+1 |
| InChI Key |
COLNVLDHVKWLRT-PTQBSOBMSA-N |
| Melting Point |
266-267 °C (dec.) (lit.) |
| Chemical Formula |
C6H5*CH2CH(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
99 atom % 13C |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
150-30-1 |
| Unlabeled Synonyms |
(±)-2-Amino-3-phenylpropionic acid; H-DL-Phe-OH |
