| Catalog Number |
ACM14246243 |
| CAS |
14246-24-3 |
| Structure |
 |
| Synonyms |
DL-PHENYLALANINE-2-D1 |
| IUPAC Name |
2-amino-3-(2-deuteriophenyl)propanoic acid |
| Molecular Weight |
166.20 |
| Molecular Formula |
C9H10DNO2 |
| Canonical SMILES |
[2H]C1=C(C=CC=C1)CC(C(=O)O)N |
| InChI |
InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/i4D |
| InChI Key |
COLNVLDHVKWLRT-QYKNYGDISA-N |
| Purity |
98 atom % D |
| Chemical Formula |
C6H5CH2CD(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
150-30-1 |
| Unlabeled Synonyms |
(±)-2-Amino-3-phenylpropionic acid; H-DL-Phe-OH |
