| Catalog Number |
ACM29909000-1 |
| CAS |
29909-00-0 |
| Structure |
 |
| Synonyms |
Alanine-2,3,3-D3,3-phenyl-D5-(8CI) |
| IUPAC Name |
2-amino-2,3,3-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| Molecular Weight |
173.24 |
| Molecular Formula |
C9H3D8NO2 |
| Canonical SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C([2H])(C(=O)O)N)[2H])[2H] |
| InChI |
InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/i1D,2D,3D,4D,5D,6D2,8D |
| InChI Key |
COLNVLDHVKWLRT-INHGFZCOSA-N |
| Melting Point |
266-267 °C (dec.) (lit.) |
| Chemical Formula |
C6D5CD2CD(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
150-30-1 |
| Unlabeled Synonyms |
(±)-2-Amino-3-phenylpropionic acid; H-DL-Phe-OH |
