| Catalog Number |
ACM284664875 |
| CAS |
284664-87-5 |
| Structure |
 |
| Synonyms |
DL-Lysine-3,3,4,4,5,5,6,6-d8 dihydrochloride, 489026_ALDRICH, 284664-87-5 |
| IUPAC Name |
2,6-diamino-3,3,4,4,5,5,6,6-octadeuteriohexanoic acid;dihydrochloride |
| Molecular Weight |
227.16 |
| Molecular Formula |
C6H8D8N2O2Cl2 |
| Canonical SMILES |
[2H]C([2H])(C(C(=O)O)N)C([2H])([2H])C([2H])([2H])C([2H])([2H])N.Cl.Cl |
| InChI |
InChI=1S/C6H14N2O2.2ClH/c7-4-2-1-3-5(8)6(9)10;;/h5H,1-4,7-8H2,(H,9,10);2*1H/i1D2,2D2,3D2,4D2;; |
| InChI Key |
JBBURJFZIMRPCZ-VHGLFXLXSA-N |
| Boiling Point |
369.8ºC at 760 mmHg |
| Melting Point |
190 °C (lit.) |
| Flash Point |
177.4ºC |
| Purity |
98 atom % D |
| Chemical Formula |
H2N(CD2)4CH(NH2)COOH·2HCl |
| Exact Mass |
226.10900 |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| CAS (Unlabeled) |
617-68-5 |
| Synonyms (Unlabeled) |
2,6-Diaminohexanoic acid 2HCl; H-DL-Lys-OH 2HCl |
