| Catalog Number |
ACM2747899-1 |
| CAS |
2747-89-9 |
| Structure |
 |
| IUPAC Name |
6-amino-2-(15N)azanylhexanoic acid;dihydrochloride |
| Molecular Weight |
220.11 |
| Molecular Formula |
C6H16Cl215NNO2 |
| Canonical SMILES |
C(CCN)CC(C(=O)O)[15NH2].Cl.Cl |
| InChI |
InChI=1S/C6H14N2O2.2ClH/c7-4-2-1-3-5(8)6(9)10;;/h5H,1-4,7-8H2,(H,9,10);2*1H/i8+1;; |
| InChI Key |
JBBURJFZIMRPCZ-IAAMHKOASA-N |
| Melting Point |
190 °C (lit.) |
| Chemical Formula |
H2N(CH2)4CH(*NH2)COOH·2HCl |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
99 atom % 15N |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
617-68-5 |
| Unlabeled Synonyms |
2,6-Diaminohexanoic acid 2HCl; H-DL-Lys-OH 2HCl |
