| Catalog Number |
ACM2747899-2 |
| CAS |
2747-89-9 |
| Structure |
 |
| Synonyms |
DL-Lysine-2-15N dihydrochloride |
| Molecular Weight |
220.11 |
| Molecular Formula |
H2N(CH2)4CH(15NH2)COOH·2HCl |
| Canonical SMILES |
Cl.Cl.NCCCCC([15NH2])C(O)=O |
| InChI |
1S/C6H14N2O2.2ClH/c7-4-2-1-3-5(8)6(9)10;;/h5H,1-4,7-8H2,(H,9,10);2*1H/i8+1;; |
| InChI Key |
JBBURJFZIMRPCZ-IAAMHKOASA-N |
| Melting Point |
190 °C (lit.) |
| Appearance |
solid |
| Storage |
Store at room temperature away from light and moisture. |
| Exact Mass |
219.056 |
| Isotopic Enrichment |
99 atom % 15N |
| LogP |
2.5319 |
| Mass Shift |
M+1 |
| MDL Number |
MFCD00084223 |
| PSA |
89.34 |
| Quality Level |
200 |
| Type |
Labeled Amino Acids and Derivatives |
| WGK Germany |
3 |
