| Catalog Number |
ACM259225406-1 |
| CAS |
259225-40-6 |
| Structure |
 |
| Synonyms |
DL-Leucine-Isopropyl-[D7] |
| IUPAC Name |
2-amino-4,5,5,5-tetradeuterio-4-(trideuteriomethyl)pentanoic acid |
| Molecular Weight |
138.22 |
| Molecular Formula |
C6H6D7NO2 |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])(CC(C(=O)O)N)C([2H])([2H])[2H] |
| InChI |
InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/i1D3,2D3,4D |
| InChI Key |
ROHFNLRQFUQHCH-UAVYNJCWSA-N |
| Melting Point |
293-296 °C (subl.) (lit.) |
| Chemical Formula |
(CD3)2CDCH2CH(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
328-39-2 |
| Unlabeled Synonyms |
(±)-2-Amino-4-methylpentanoic acid; (±)-2-Amino-iso-caproic acid; H-DL-Leu-OH |
