| Catalog Number |
ACM108641823-1 |
| CAS |
108641-82-3 |
| Structure |
 |
| IUPAC Name |
2-amino-4-[(3-amino-3-carboxy-1,1,2,2-tetradeuteriopropyl)disulfanyl]-3,3,4,4-tetradeuteriobutanoic acid |
| Molecular Weight |
276.39 |
| Molecular Formula |
C8H8D8N2O4S2 |
| Canonical SMILES |
[2H]C([2H])(C(C(=O)O)N)C([2H])([2H])SSC([2H])([2H])C([2H])([2H])C(C(=O)O)N |
| InChI |
InChI=1S/C8H16N2O4S2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14)/i1D2,2D2,3D2,4D2 |
| InChI Key |
ZTVZLYBCZNMWCF-SVYQBANQSA-N |
| Chemical Formula |
[HOOCCH(NH2)CD2CD2S]2 |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
870-93-9 |
| Unlabeled Synonyms |
4,4'-Dithio-bis(2-aminobutanoic acid); (H-DL-Homocys-OH)2 |
