| Catalog Number |
ACM96927569 |
| CAS |
96927-56-9 |
| Structure |
 |
| Synonyms |
DL-GLUTAMIC-2,4,4-D3 ACID;DL-GLUTAMIC ACID (2,4,4-D3);DL-Glutamic Acid-2,2,4-D3 |
| IUPAC Name |
2-amino-2,4,4-trideuteriopentanedioic acid |
| Molecular Weight |
150.15 |
| Molecular Formula |
C5H6D3NO4 |
| Canonical SMILES |
[2H]C([2H])(CC([2H])(C(=O)O)N)C(=O)O |
| InChI |
InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/i2D2,3D |
| InChI Key |
WHUUTDBJXJRKMK-UHVFUKFASA-N |
| Boiling Point |
333.783ºC at 760 mmHg |
| Melting Point |
185 °C (dec.) (lit.) |
| Purity |
98 atom % D |
| Density |
1.439 g/cm³ |
| Chemical Formula |
HOOCCD2CH2CD(NH2)COOH |
| Exact Mass |
150.07200 |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| CAS (Unlabeled) |
617-65-2 |
| Synonyms (Unlabeled) |
(±)-2-Aminoglutaric acid; H-DL-Glu-OH |
