| Catalog Number |
ACM14341754-1 |
| CAS |
14341-75-4 |
| Structure |
 |
| Synonyms |
Aspartic-2,3,3-D3 acid |
| IUPAC Name |
2-amino-2,3,3-trideuteriobutanedioic acid |
| Molecular Weight |
136.12 |
| Molecular Formula |
C4H4D3NO4 |
| Canonical SMILES |
[2H]C([2H])(C(=O)O)C([2H])(C(=O)O)N |
| InChI |
InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/i1D2,2D |
| InChI Key |
CKLJMWTZIZZHCS-FUDHJZNOSA-N |
| Melting Point |
>300 °C (dec.) (lit.) |
| Chemical Formula |
HOOCCD2CD(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
617-45-8 |
| Unlabeled Synonyms |
DL-Asparaginic acid; (±)-2-Aminosuccinic acid; H-DL-Asp-OH |
