Catalog Number |
ACM350820176-1 |
CAS |
350820-17-6 |
Structure |
|
Synonyms |
D6-2-Aminobutyric acid |
IUPAC Name |
2-amino-2,3,3,4,4,4-hexadeuteriobutanoic acid |
Molecular Weight |
109.16 |
Molecular Formula |
C4H3D6NO2 |
Canonical SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])(C(=O)O)N |
InChI |
InChI=1S/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/i1D3,2D2,3D |
InChI Key |
QWCKQJZIFLGMSD-LIDOUZCJSA-N |
Chemical Formula |
CD3CD2CD(NH2)COOH |
Hazards |
Non-hazardous for transport. |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
Unlabeled CAS |
2835-81-6 |
Unlabeled Synonyms |
α-Aminobutyric acid; H-DL-Abu-OH |