Disperse red 1 D3 (N-ethyl-2,2,2-D3)
| Catalog Number |
ACM947601970-1 |
| CAS |
947601-97-0 |
| Structure |
 |
| Synonyms |
Ethanol, 2-[ethyl-2,2,2-d3-[4-[(1Z)-2-(4-nitrophenyl)diazenyl]phenyl]amino]- |
| IUPAC Name |
2-[4-[(4-nitrophenyl)diazenyl]-N-(2,2,2-trideuterioethyl)anilino]ethanol |
| Molecular Weight |
317.36 |
| Molecular Formula |
C16D3H15N4O3 |
| InChI |
InChI=1S/C16H18N4O3/c1-2-19(11-12-21)15-7-3-13(4-8-15)17-18-14-5-9-16(10-6-14)20(22)23/h3-10,21H,2,11-12H2,1H3/i1D3 |
| InChI Key |
FOQABOMYTOFLPZ-FIBGUPNXSA-N |
| Accurate Mass |
317.1567 |
| Format |
Neat |
| Isomeric SMILES |
[2H]C([2H])([2H])CN(CCO)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)[N+](=O)[O-] |
| Shipping Temperature |
>20 °C |
| Storage Conditions |
>20 °C |
| Unlabeled CAS |
2872-52-8 |
Please kindly note that our products and services are for research use only.
