| Catalog Number |
ACM107632224 |
| CAS |
107632-22-4 |
| Structure |
 |
| Synonyms |
Disodium;deuterio phosphate |
| IUPAC Name |
disodium;deuterio phosphate |
| Molecular Weight |
142.96 |
| Molecular Formula |
Na2DPO4 |
| InChI |
InChI=1S/2Na.H3O4P/c;;1-5(2,3)4/h;;(H3,1,2,3,4)/q2*+1;/p-2/i/hD |
| InChI Key |
BNIILDVGGAEEIG-DYCDLGHISA-L |
| Purity |
98 atom % D |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]OP(=O)([O-])[O-].[Na+].[Na+] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
7558-79-4 |
| Unlabeled Synonyms |
Sodium phosphate dibasic |
