| Catalog Number |
ACM99234910-1 |
| CAS |
99234-91-0 |
| Structure |
 |
| Synonyms |
Benzen-2,4,6-d3-amine, N-(phenyl-2,4,6-d3)- (9CI) |
| IUPAC Name |
2,4,6-trideuterio-N-(2,4,6-trideuteriophenyl)aniline |
| Molecular Weight |
175.26 |
| Molecular Formula |
C12D6H5N |
| Canonical SMILES |
[2H]c1cc([2H])c(Nc2c([2H])cc([2H])cc2[2H])c([2H])c1 |
| InChI |
InChI=1S/C12H11N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13H/i1D,2D,7D,8D,9D,10D |
| Purity |
98 atom % D |
| Accurate Mass |
175.1268 |
| Format |
Neat |
| Functional Group |
Amines & Amine Salts |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.1 g
In Stock
0.25 g
In Stock |
| Shipping Hazards |
TOXIC (PGIII) |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
122-39-4 |
