| Catalog Number |
ACM93952057 |
| CAS |
93952-05-7 |
| Structure |
 |
| Synonyms |
Phenyl Ether; Biphenyl Oxide; Phenoxybenzene |
| IUPAC Name |
1,2,3,4,5-pentadeuterio-6-(2,3,4,5,6-pentadeuteriophenoxy)benzene |
| Molecular Weight |
180.27 |
| Molecular Formula |
C6D5OC6D5 |
| InChI |
InChI=1S/C12H10O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChI Key |
USIUVYZYUHIAEV-LHNTUAQVSA-N |
| Chemical Formula |
C6D5OC6D5 |
| Exact Mass |
180.1359 |
| Functional Group |
Ethers & Oxides |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])OC2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Monoisotopic Mass |
180.1359 |
| Packaging |
0.5 g
In Stock
1 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
101-84-8 |
| Unlabeled Synonyms |
Phenyl ether; Biphenyl oxide; Phenoxybenzene |
