| Catalog Number |
ACM37055519 |
| CAS |
37055-51-9 |
| Structure |
 |
| Synonyms |
N-Phenylaniline |
| IUPAC Name |
2,3,4,5,6-pentadeuterio-N-(2,3,4,5,6-pentadeuteriophenyl)aniline |
| Molecular Weight |
179.29 |
| Molecular Formula |
(C6D5)2NH |
| Canonical SMILES |
C1=CC=C(C=C1)NC2=CC=CC=C2 |
| InChI Key |
DMBHHRLKUKUOEG-LHNTUAQVSA-N |
| Purity |
98 atom % D |
| Exact Mass |
179.15200 |
| Functional Group |
Amines & Amine Salts |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.1 g
In Stock
0.5 g
In Stock |
| Shipping Hazards |
TOXIC (PGIII) |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
122-39-4 |
