2,6-Dinitrotoluene-alpha,alpha,alpha-d3 (98 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM93951907-2 |
| CAS |
93951-90-7 |
| Structure |
 |
| Synonyms |
Benzene, 2-(methyl-d3)-1,3-dinitro- (9CI), 2,6-Dinitrotoluene (methyl-D3), 2-Trideuteromethyl-1,3-dinitrobenzene |
| IUPAC Name |
1,3-dinitro-2-(trideuteriomethyl)benzene |
| Molecular Weight |
185.15 |
| Molecular Formula |
C7D3H3N2O4 |
| Canonical SMILES |
[2H]C([2H])([2H])c1c(cccc1[N+](=O)[O-])[N+](=O)[O-] |
| InChI |
InChI=1S/C7H6N2O4/c1-5-6(8(10)11)3-2-4-7(5)9(12)13/h2-4H,1H3/i1D3 |
| Accurate Mass |
185.0516 |
| Format |
Neat |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
