2,4-Dinitrotoluene-alpha,alpha,alpha-d3 (98 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM70786684-2 |
| CAS |
70786-68-4 |
| Structure |
 |
| Synonyms |
Benzene, 1-(methyl-d3)-2,4-dinitro- (9CI), 2,4-Dinitrotoluene (methyl-D3), 1-Trideuteromethyl-2,4-dinitrobenzene |
| IUPAC Name |
2,4-dinitro-1-(trideuteriomethyl)benzene |
| Molecular Weight |
185.15 |
| Molecular Formula |
C7D3H3N2O4 |
| Canonical SMILES |
[2H]C([2H])([2H])c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
| InChI |
InChI=1S/C7H6N2O4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4H,1H3/i1D3 |
| Accurate Mass |
185.0516 |
| Format |
Neat |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
