| Catalog Number |
ACM93951769-1 |
| CAS |
93951-76-9 |
| Structure |
 |
| Synonyms |
Phen-3,5-d2-ol, 2-methyl-4,6-dinitro- (9CI), DNOC D2 (ring-D2), 2-Methyl-4,6-dinitrophenol (ring-D2), 2-Methyl-3,5-dideuterio-4,6-dinitrophenol, 3,5-Dideuterio-2-methyl-4,6-dinitrophenol |
| IUPAC Name |
3,5-dideuterio-2-methyl-4,6-dinitrophenol |
| Molecular Weight |
200.15 |
| Molecular Formula |
C7DD4N2O5 |
| Canonical SMILES |
[2H]c1c(C)c(O)c(c([2H])c1[N+](=O)[O-])[N+](=O)[O-] |
| InChI |
InChI=1S/C7H6N2O5/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14/h2-3,10H,1H3/i2D,3D |
| Purity |
98 atom % D |
| Accurate Mass |
200.0402 |
| Format |
Neat |
| Functional Group |
Alcohols & Phenols,Nitro & Nitroso Compounds |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.05 g
In Stock
0.1 g
In Stock |
| Shipping Hazards |
TOXIC |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
534-52-1 |
