2,4-Dimethylphenol-d10 (98 atom % D, min 97% Chemical Purity)
| Catalog Number |
ACM1219794861-1 |
| CAS |
1219794-86-1 |
| Structure |
 |
| Synonyms |
2,4-Dimethylphenol D10, 2,4-Dimethylphenol-d10, 2,4-Bis(trideuteriomethyl-3,5,6-trideuteriophenol-OD, Perdeuterio-2,4-dimethylphenol |
| IUPAC Name |
1,2,5-trideuterio-3-deuteriooxy-4,6-bis(trideuteriomethyl)benzene |
| Molecular Weight |
132.23 |
| Molecular Formula |
C8D10O |
| Canonical SMILES |
[2H]Oc1c([2H])c([2H])c(c([2H])c1C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C8H10O/c1-6-3-4-8(9)7(2)5-6/h3-5,9H,1-2H3/i1D3,2D3,3D,4D,5D/hD |
| Accurate Mass |
132.1359 |
| Format |
Neat |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
