| Catalog Number |
ACM30994231 |
| CAS |
30994-23-1 |
| Structure |
 |
| Synonyms |
Dimethyl succinate-2,2,3,3-D4 |
| IUPAC Name |
dimethyl 2,2,3,3-tetradeuteriobutanedioate |
| Molecular Weight |
150.17 |
| Molecular Formula |
C6H6D4O4 |
| Canonical SMILES |
COC(=O)CCC(=O)OC |
| InChI |
InChI=1S/C6H10O4/c1-9-5(7)3-4-6(8)10-2/h3-4H2,1-2H3/i3D2,4D2 |
| InChI Key |
MUXOBHXGJLMRAB-KHORGVISSA-N |
| Boiling Point |
200 °C (lit.) |
| Melting Point |
18-19 °C (lit.) |
| Flash Point |
185 °F |
| Purity |
98 atom % D |
| Density |
1.148 g/mL at 25 °C |
| Chemical Formula |
CH3OOC(CD2)2COOCH3 |
| Exact Mass |
150.08300 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C(=O)OC)C([2H])([2H])C(=O)OC |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
106-65-0 |
| Unlabeled Synonyms |
Methyl succinate; Dimethyl butanedioate |
