| Catalog Number |
ACM362049443-1 |
| CAS |
362049-44-3 |
| Structure |
 |
| Synonyms |
m-Dimethoxybenzene; Resorcinol Dimethyl Ether |
| IUPAC Name |
1,2,3,5-tetradeuterio-4,6-dimethoxybenzene |
| Molecular Weight |
142.19 |
| Molecular Formula |
C6D4(OCH3)2 |
| InChI |
InChI=1S/C8H10O2/c1-9-7-4-3-5-8(6-7)10-2/h3-6H,1-2H3/i3D,4D,5D,6D |
| InChI Key |
DPZNOMCNRMUKPS-LNFUJOGGSA-N |
| Chemical Formula |
C6D4(OCH3)2 |
| Functional Group |
Ethers & Oxides |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])OC)[2H])OC)[2H] |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.25 g
In Stock
0.5 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
151-10-0 |
| Unlabeled Synonyms |
m-Dimethoxybenzene |
